C14H18F2 — CID 116841647
1-[cyclopropyl(difluoro)methyl]-4-(2-methylpropyl)benzene (PubChem CID 116841647) has the molecular formula C14H18F2 and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-[cyclopropyl(difluoro)methyl]-4-(2-methylpropyl)benzene.
| Compound Name | 1-[cyclopropyl(difluoro)methyl]-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 116841647 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[cyclopropyl(difluoro)methyl]-4-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1ccc(C(F)(F)C2CC2)cc1 |
| InChI | InChI=1S/C14H18F2/c1-10(2)9-11-3-5-12(6-4-11)14(15,16)13-7-8-13/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | DJTYPRWSNAICPB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |