C23H18ClF3 — CID 58698674
1-chloro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 58698674) has the molecular formula C23H18ClF3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-chloro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 1-chloro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698674 |
| Molecular Formula | C23H18ClF3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-chloro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)[C@@H](Cc1ccc(C=Cc2ccc(Cl)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H18ClF3/c24-21-14-12-18(13-15-21)7-6-17-8-10-19(11-9-17)16-22(23(25,26)27)20-4-2-1-3-5-20/h1-15,22H,16H2/t22-/m0/s1 |
| InChIKey | CZLLTUUOPBLGHJ-QFIPXVFZSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|