C23H17ClF4 — CID 58698513
4-[2-(4-chlorophenyl)ethenyl]-2-fluoro-1-[(2R)-3,3,3-trifluoro-2-phenylpropyl]benzene (PubChem CID 58698513) has the molecular formula C23H17ClF4 and a molecular weight of 404.83 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethenyl]-2-fluoro-1-[(2R)-3,3,3-trifluoro-2-phenylpropyl]benzene.
| Compound Name | 4-[2-(4-chlorophenyl)ethenyl]-2-fluoro-1-[(2R)-3,3,3-trifluoro-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58698513 |
| Molecular Formula | C23H17ClF4 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethenyl]-2-fluoro-1-[(2R)-3,3,3-trifluoro-2-phenylpropyl]benzene |
| SMILES | Fc1cc(C=Cc2ccc(Cl)cc2)ccc1C[C@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H17ClF4/c24-20-12-9-16(10-13-20)6-7-17-8-11-19(22(25)14-17)15-21(23(26,27)28)18-4-2-1-3-5-18/h1-14,21H,15H2/t21-/m1/s1 |
| InChIKey | HIDXHSFLNRGPEK-OAQYLSRUSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|