C25H24F2 — CID 58698955
2-fluoro-4-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethenyl]-1-propylbenzene (PubChem CID 58698955) has the molecular formula C25H24F2 and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethenyl]-1-propylbenzene.
| Compound Name | 2-fluoro-4-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethenyl]-1-propylbenzene |
|---|---|
| PubChem CID | 58698955 |
| Molecular Formula | C25H24F2 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-fluoro-4-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethenyl]-1-propylbenzene |
| SMILES | CCCc1ccc(C=Cc2ccc(C[C@H](F)c3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C25H24F2/c1-2-6-22-16-15-21(18-24(22)26)14-11-19-9-12-20(13-10-19)17-25(27)23-7-4-3-5-8-23/h3-5,7-16,18,25H,2,6,17H2,1H3/t25-/m0/s1 |
| InChIKey | JDWBLZRVRAFVBX-VWLOTQADSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|