C24H22F2O — CID 58698898
1-[2-(4-ethoxyphenyl)ethenyl]-2-fluoro-4-[(2R)-2-fluoro-2-phenylethyl]benzene (PubChem CID 58698898) has the molecular formula C24H22F2O and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[2-(4-ethoxyphenyl)ethenyl]-2-fluoro-4-[(2R)-2-fluoro-2-phenylethyl]benzene.
| Compound Name | 1-[2-(4-ethoxyphenyl)ethenyl]-2-fluoro-4-[(2R)-2-fluoro-2-phenylethyl]benzene |
|---|---|
| PubChem CID | 58698898 |
| Molecular Formula | C24H22F2O |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[2-(4-ethoxyphenyl)ethenyl]-2-fluoro-4-[(2R)-2-fluoro-2-phenylethyl]benzene |
| SMILES | CCOc1ccc(C=Cc2ccc(C[C@@H](F)c3ccccc3)cc2F)cc1 |
| InChI | InChI=1S/C24H22F2O/c1-2-27-22-14-10-18(11-15-22)8-12-21-13-9-19(17-24(21)26)16-23(25)20-6-4-3-5-7-20/h3-15,17,23H,2,16H2,1H3/t23-/m1/s1 |
| InChIKey | DOOSJEILQARNLL-HSZRJFAPSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|