C22H19ClF2 — CID 71103035
4-chloro-2-fluoro-1-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethyl]benzene (PubChem CID 71103035) has the molecular formula C22H19ClF2 and a molecular weight of 356.84 g/mol. Its IUPAC name is 4-chloro-2-fluoro-1-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethyl]benzene.
| Compound Name | 4-chloro-2-fluoro-1-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 71103035 |
| Molecular Formula | C22H19ClF2 |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-chloro-2-fluoro-1-[2-[4-[(2S)-2-fluoro-2-phenylethyl]phenyl]ethyl]benzene |
| SMILES | Fc1cc(Cl)ccc1CCc1ccc(C[C@H](F)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19ClF2/c23-20-13-12-19(22(25)15-20)11-10-16-6-8-17(9-7-16)14-21(24)18-4-2-1-3-5-18/h1-9,12-13,15,21H,10-11,14H2/t21-/m0/s1 |
| InChIKey | QPMZQYXNPOZXDI-NRFANRHFSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |