C23H17F5 — CID 21052475
1,2-difluoro-4-[(E)-2-[4-(3,3,3-trifluoro-2-phenylpropyl)phenyl]ethenyl]benzene (PubChem CID 21052475) has the molecular formula C23H17F5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 1,2-difluoro-4-[(E)-2-[4-(3,3,3-trifluoro-2-phenylpropyl)phenyl]ethenyl]benzene.
| Compound Name | 1,2-difluoro-4-[(E)-2-[4-(3,3,3-trifluoro-2-phenylpropyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 21052475 |
| Molecular Formula | C23H17F5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1,2-difluoro-4-[(E)-2-[4-(3,3,3-trifluoro-2-phenylpropyl)phenyl]ethenyl]benzene |
| SMILES | Fc1ccc(/C=C/c2ccc(CC(c3ccccc3)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C23H17F5/c24-21-13-12-18(15-22(21)25)11-8-16-6-9-17(10-7-16)14-20(23(26,27)28)19-4-2-1-3-5-19/h1-13,15,20H,14H2/b11-8+ |
| InChIKey | IEYCSXSIGWKOIQ-DHZHZOJOSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|