C28H27F3 — CID 91115547
1-pent-3-enyl-4-[2-[4-[(2R)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 91115547) has the molecular formula C28H27F3 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-pent-3-enyl-4-[2-[4-[(2R)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 1-pent-3-enyl-4-[2-[4-[(2R)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 91115547 |
| Molecular Formula | C28H27F3 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-pent-3-enyl-4-[2-[4-[(2R)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | CC=CCCc1ccc(C=Cc2ccc(C[C@H](c3ccccc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H27F3/c1-2-3-5-8-22-11-13-23(14-12-22)15-16-24-17-19-25(20-18-24)21-27(28(29,30)31)26-9-6-4-7-10-26/h2-4,6-7,9-20,27H,5,8,21H2,1H3/t27-/m1/s1 |
| InChIKey | CEVKKSORSRFDMD-HHHXNRCGSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|