C15H23F3N2O — CID 105275446
[3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]hydrazine (PubChem CID 105275446) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is [3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]hydrazine.
| Compound Name | [3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105275446 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-yl]hydrazine |
| SMILES | CCC(CC)(OC)C(Cc1ccc(C(F)(F)F)cc1)NN |
| InChI | InChI=1S/C15H23F3N2O/c1-4-14(5-2,21-3)13(20-19)10-11-6-8-12(9-7-11)15(16,17)18/h6-9,13,20H,4-5,10,19H2,1-3H3 |
| InChIKey | WMJHFQQWKVEJRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|