C27H24N2O3 — CID 42939591
2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[(1-phenylcyclopropyl)methyl]propanamide (PubChem CID 42939591) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[(1-phenylcyclopropyl)methyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[(1-phenylcyclopropyl)methyl]propanamide |
|---|---|
| PubChem CID | 42939591 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[(1-phenylcyclopropyl)methyl]propanamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H24N2O3/c30-24(28-18-27(15-16-27)20-11-5-2-6-12-20)23(17-19-9-3-1-4-10-19)29-25(31)21-13-7-8-14-22(21)26(29)32/h1-14,23H,15-18H2,(H,28,30) |
| InChIKey | WHNBPECJVASRJU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|