C21H20N2O3S — CID 2678445
2-[(2S)-1-(2,3-dihydroindol-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 2678445) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[(2S)-1-(2,3-dihydroindol-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-(2,3-dihydroindol-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2678445 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-[(2S)-1-(2,3-dihydroindol-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CSCC[C@@H](C(=O)N1CCc2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O3S/c1-27-13-11-18(21(26)22-12-10-14-6-2-5-9-17(14)22)23-19(24)15-7-3-4-8-16(15)20(23)25/h2-9,18H,10-13H2,1H3/t18-/m0/s1 |
| InChIKey | HATNVFICYUTWCZ-SFHVURJKSA-N |
| XLogP | 2.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|