C26H28N2O5S — CID 40944828
2-[(2R)-1-[(7S)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl]-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 40944828) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[(2R)-1-[(7S)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl]-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-[(7S)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl]-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 40944828 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[(2R)-1-[(7S)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl]-4-methylsulfanyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CSCC[C@H](C(=O)N1CCc2cc3c(cc2[C@@H]1C)OCCCO3)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H28N2O5S/c1-16-20-15-23-22(32-11-5-12-33-23)14-17(20)8-10-27(16)26(31)21(9-13-34-2)28-24(29)18-6-3-4-7-19(18)25(28)30/h3-4,6-7,14-16,21H,5,8-13H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | VWXCMGOJTFJTKZ-HRAATJIYSA-N |
| XLogP | 3.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|