C23H24N2O3 — CID 2394867
2-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 2394867) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2394867 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C[C@@H](C(=O)N1CCCc2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24N2O3/c1-15(2)14-20(25-21(26)17-10-4-5-11-18(17)22(25)27)23(28)24-13-7-9-16-8-3-6-12-19(16)24/h3-6,8,10-12,15,20H,7,9,13-14H2,1-2H3/t20-/m0/s1 |
| InChIKey | TXNPCVBYRWYBCV-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|