C26H31N3O5S — CID 26765345
1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 26765345) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 26765345 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)[C@@H](CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H31N3O5S/c1-5-27(6-2)35(33,34)19-11-12-22-18(16-19)13-14-28(22)26(32)23(15-17(3)4)29-24(30)20-9-7-8-10-21(20)25(29)31/h7-12,16-17,23H,5-6,13-15H2,1-4H3/t23-/m1/s1 |
| InChIKey | IRBRJJDONZAOCY-HSZRJFAPSA-N |
| XLogP | 3.32 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|