C22H28N2O5S2 — CID 55667997
N,N-diethyl-1-(2-propan-2-ylsulfonylbenzoyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 55667997) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N,N-diethyl-1-(2-propan-2-ylsulfonylbenzoyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-(2-propan-2-ylsulfonylbenzoyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55667997 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N,N-diethyl-1-(2-propan-2-ylsulfonylbenzoyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)c1ccccc1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C22H28N2O5S2/c1-5-23(6-2)31(28,29)18-11-12-20-17(15-18)13-14-24(20)22(25)19-9-7-8-10-21(19)30(26,27)16(3)4/h7-12,15-16H,5-6,13-14H2,1-4H3 |
| InChIKey | QBIUUNITHHNUDM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |