C16H25N3O3S — CID 53059052
5-(diethylsulfamoyl)-N-propyl-2,3-dihydroindole-1-carboxamide (PubChem CID 53059052) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-propyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-(diethylsulfamoyl)-N-propyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 53059052 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-propyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCCNC(=O)N1CCc2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C16H25N3O3S/c1-4-10-17-16(20)19-11-9-13-12-14(7-8-15(13)19)23(21,22)18(5-2)6-3/h7-8,12H,4-6,9-11H2,1-3H3,(H,17,20) |
| InChIKey | ANIUXHIYMUXNPA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |