C24H26N2O3 — CID 2559883
(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide (PubChem CID 2559883) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
|---|---|
| PubChem CID | 2559883 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
| SMILES | CC(C)CC(C(=O)N[C@@H]1CCCc2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H26N2O3/c1-15(2)14-21(26-23(28)18-11-5-6-12-19(18)24(26)29)22(27)25-20-13-7-9-16-8-3-4-10-17(16)20/h3-6,8,10-12,15,20-21H,7,9,13-14H2,1-2H3,(H,25,27)/t20-,21?/m1/s1 |
| InChIKey | WIJMKVCYDZSSSP-VQCQRNETSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|