C22H29N3O4 — CID 110285122
N-[2-(cyclohexylamino)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 110285122) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 110285122 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NCC(=O)NC1CCCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)12-18(25-21(28)16-10-6-7-11-17(16)22(25)29)20(27)23-13-19(26)24-15-8-4-3-5-9-15/h6-7,10-11,14-15,18H,3-5,8-9,12-13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | GFLFPDYDRRFHJK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|