C27H30N2O5 — CID 19165550
cyclohexyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate (PubChem CID 19165550) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is cyclohexyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19165550 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | cyclohexyl 4-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzoate |
| SMILES | CC(C)CC(C(=O)Nc1ccc(C(=O)OC2CCCCC2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H30N2O5/c1-17(2)16-23(29-25(31)21-10-6-7-11-22(21)26(29)32)24(30)28-19-14-12-18(13-15-19)27(33)34-20-8-4-3-5-9-20/h6-7,10-15,17,20,23H,3-5,8-9,16H2,1-2H3,(H,28,30) |
| InChIKey | GTPYAUBWGFJOAI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|