C28H29NO4 — CID 19191526
cyclohexyl 4-[2-(4-phenylphenoxy)propanoylamino]benzoate (PubChem CID 19191526) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is cyclohexyl 4-[2-(4-phenylphenoxy)propanoylamino]benzoate.
| Compound Name | cyclohexyl 4-[2-(4-phenylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19191526 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | cyclohexyl 4-[2-(4-phenylphenoxy)propanoylamino]benzoate |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)Nc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-20(32-26-18-14-22(15-19-26)21-8-4-2-5-9-21)27(30)29-24-16-12-23(13-17-24)28(31)33-25-10-6-3-7-11-25/h2,4-5,8-9,12-20,25H,3,6-7,10-11H2,1H3,(H,29,30) |
| InChIKey | PTBVGACBGXNTCP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |