C26H33NO4 — CID 19203455
cyclohexyl 4-[2-(4-tert-butylphenoxy)propanoylamino]benzoate (PubChem CID 19203455) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is cyclohexyl 4-[2-(4-tert-butylphenoxy)propanoylamino]benzoate.
| Compound Name | cyclohexyl 4-[2-(4-tert-butylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19203455 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | cyclohexyl 4-[2-(4-tert-butylphenoxy)propanoylamino]benzoate |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-18(30-23-16-12-20(13-17-23)26(2,3)4)24(28)27-21-14-10-19(11-15-21)25(29)31-22-8-6-5-7-9-22/h10-18,22H,5-9H2,1-4H3,(H,27,28) |
| InChIKey | KOLTUVFNFVFVTL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |