C22H24FNO4 — CID 7695417
cyclohexyl (2R)-2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate (PubChem CID 7695417) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is cyclohexyl (2R)-2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | cyclohexyl (2R)-2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 7695417 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | cyclohexyl (2R)-2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate |
| SMILES | C[C@@H](Oc1ccc(C(=O)Nc2ccc(F)cc2)cc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C22H24FNO4/c1-15(22(26)28-19-5-3-2-4-6-19)27-20-13-7-16(8-14-20)21(25)24-18-11-9-17(23)10-12-18/h7-15,19H,2-6H2,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | XQLBBDAVYWSDPV-OAHLLOKOSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |