C23H27FN2O2 — CID 58708194
N-[(1R)-1-cyclohexylethyl]-4-[(4-fluorobenzoyl)amino]-N-methylbenzamide (PubChem CID 58708194) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-4-[(4-fluorobenzoyl)amino]-N-methylbenzamide.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-4-[(4-fluorobenzoyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 58708194 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-4-[(4-fluorobenzoyl)amino]-N-methylbenzamide |
| SMILES | C[C@H](C1CCCCC1)N(C)C(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27FN2O2/c1-16(17-6-4-3-5-7-17)26(2)23(28)19-10-14-21(15-11-19)25-22(27)18-8-12-20(24)13-9-18/h8-17H,3-7H2,1-2H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | UFBMYVPISVLEHC-MRXNPFEDSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |