C21H28N2O3 — CID 51405232
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S,2R)-2-methylcyclohexyl]pentanamide (PubChem CID 51405232) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S,2R)-2-methylcyclohexyl]pentanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S,2R)-2-methylcyclohexyl]pentanamide |
|---|---|
| PubChem CID | 51405232 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S,2R)-2-methylcyclohexyl]pentanamide |
| SMILES | CC(C)C[C@H](C(=O)N[C@H]1CCCC[C@H]1C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H28N2O3/c1-13(2)12-18(19(24)22-17-11-7-4-8-14(17)3)23-20(25)15-9-5-6-10-16(15)21(23)26/h5-6,9-10,13-14,17-18H,4,7-8,11-12H2,1-3H3,(H,22,24)/t14-,17+,18-/m1/s1 |
| InChIKey | ABRGCZHTDZNRSB-FHLIZLRMSA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|