C32H27N3O9 — CID 19187507
[2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 19187507) has the molecular formula C32H27N3O9 and a molecular weight of 597.58 g/mol. Its IUPAC name is [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 19187507 |
| Molecular Formula | C32H27N3O9 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Oc1ccc2cc(C(=O)NCCc3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C32H27N3O9/c36-27(12-5-2-6-17-34-30(38)23-10-7-11-25(35(41)42)28(23)31(34)39)43-22-14-13-21-18-24(32(40)44-26(21)19-22)29(37)33-16-15-20-8-3-1-4-9-20/h1,3-4,7-11,13-14,18-19H,2,5-6,12,15-17H2,(H,33,37) |
| InChIKey | FEORKSZPECNYCT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|