C36H54O5 — CID 59245474
4-[(E)-2-[4-methyl-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)benzaldehyde (PubChem CID 59245474) has the molecular formula C36H54O5 and a molecular weight of 566.82 g/mol. Its IUPAC name is 4-[(E)-2-[4-methyl-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)benzaldehyde.
| Compound Name | 4-[(E)-2-[4-methyl-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)benzaldehyde |
|---|---|
| PubChem CID | 59245474 |
| Molecular Formula | C36H54O5 |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | 4-[(E)-2-[4-methyl-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)benzaldehyde |
| SMILES | Cc1cc(OCCC(C)C)c(/C=C/c2cc(OCCC(C)C)c(C=O)cc2OCCC(C)C)cc1OCCC(C)C |
| InChI | InChI=1S/C36H54O5/c1-25(2)12-16-38-33-21-30(34(20-29(33)9)39-17-13-26(3)4)10-11-31-22-36(41-19-15-28(7)8)32(24-37)23-35(31)40-18-14-27(5)6/h10-11,20-28H,12-19H2,1-9H3/b11-10+ |
| InChIKey | ORRYMSPULZESDI-ZHACJKMWSA-N |
| XLogP | 9.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|