C34H54B2O8 — CID 23302151
[4-[(E)-2-[4-borono-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)phenyl]boronic acid (PubChem CID 23302151) has the molecular formula C34H54B2O8 and a molecular weight of 612.42 g/mol. Its IUPAC name is [4-[(E)-2-[4-borono-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)phenyl]boronic acid.
| Compound Name | [4-[(E)-2-[4-borono-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 23302151 |
| Molecular Formula | C34H54B2O8 |
| Molecular Weight | 612.42 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | [4-[(E)-2-[4-borono-2,5-bis(3-methylbutoxy)phenyl]ethenyl]-2,5-bis(3-methylbutoxy)phenyl]boronic acid |
| SMILES | CC(C)CCOc1cc(B(O)O)c(OCCC(C)C)cc1/C=C/c1cc(OCCC(C)C)c(B(O)O)cc1OCCC(C)C |
| InChI | InChI=1S/C34H54B2O8/c1-23(2)11-15-41-31-21-29(35(37)38)33(43-17-13-25(5)6)19-27(31)9-10-28-20-34(44-18-14-26(7)8)30(36(39)40)22-32(28)42-16-12-24(3)4/h9-10,19-26,37-40H,11-18H2,1-8H3/b10-9+ |
| InChIKey | HUANVKQAJLUMDM-MDZDMXLPSA-N |
| XLogP | 4.92 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|