C36H56O2 — CID 58908179
1,4-bis(3,7-dimethyloctoxy)-2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]benzene (PubChem CID 58908179) has the molecular formula C36H56O2 and a molecular weight of 520.84 g/mol. Its IUPAC name is 1,4-bis(3,7-dimethyloctoxy)-2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis(3,7-dimethyloctoxy)-2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 58908179 |
| Molecular Formula | C36H56O2 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.43 |
| IUPAC Name | 1,4-bis(3,7-dimethyloctoxy)-2-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]benzene |
| SMILES | Cc1ccc(/C=C/c2cc(OCCC(C)CCCC(C)C)c(C)cc2OCCC(C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C36H56O2/c1-27(2)11-9-13-29(5)21-23-37-35-26-34(20-19-33-17-15-31(7)16-18-33)36(25-32(35)8)38-24-22-30(6)14-10-12-28(3)4/h15-20,25-30H,9-14,21-24H2,1-8H3/b20-19+ |
| InChIKey | XFIHVCVEYFISRL-FMQUCBEESA-N |
| XLogP | 10.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|