C25H38O3 — CID 71440726
4-ethynyl-2,5-dioctoxybenzaldehyde (PubChem CID 71440726) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-ethynyl-2,5-dioctoxybenzaldehyde.
| Compound Name | 4-ethynyl-2,5-dioctoxybenzaldehyde |
|---|---|
| PubChem CID | 71440726 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 4-ethynyl-2,5-dioctoxybenzaldehyde |
| SMILES | C#Cc1cc(OCCCCCCCC)c(C=O)cc1OCCCCCCCC |
| InChI | InChI=1S/C25H38O3/c1-4-7-9-11-13-15-17-27-24-20-23(21-26)25(19-22(24)6-3)28-18-16-14-12-10-8-5-2/h3,19-21H,4-5,7-18H2,1-2H3 |
| InChIKey | DLBYHRLUSVOIJW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|