C40H49NO4 — CID 177421648
1-[(E)-2-(4-ethynylphenyl)ethenyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxybenzene (PubChem CID 177421648) has the molecular formula C40H49NO4 and a molecular weight of 607.84 g/mol. Its IUPAC name is 1-[(E)-2-(4-ethynylphenyl)ethenyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxybenzene.
| Compound Name | 1-[(E)-2-(4-ethynylphenyl)ethenyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxybenzene |
|---|---|
| PubChem CID | 177421648 |
| Molecular Formula | C40H49NO4 |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | 1-[(E)-2-(4-ethynylphenyl)ethenyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxybenzene |
| SMILES | C#Cc1ccc(/C=C/c2cc(OCCCCCCCC)c(/C=C/c3ccc([N+](=O)[O-])cc3)cc2OCCCCCCCC)cc1 |
| InChI | InChI=1S/C40H49NO4/c1-4-7-9-11-13-15-29-44-39-32-37(26-22-35-23-27-38(28-24-35)41(42)43)40(45-30-16-14-12-10-8-5-2)31-36(39)25-21-34-19-17-33(6-3)18-20-34/h3,17-28,31-32H,4-5,7-16,29-30H2,1-2H3/b25-21+,26-22+ |
| InChIKey | SOSAMTSBAWKTTF-CDTUYSNOSA-N |
| XLogP | 11.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|