C35H53NO4Si — CID 10627055
trimethyl-[1-[4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]silane (PubChem CID 10627055) has the molecular formula C35H53NO4Si and a molecular weight of 579.90 g/mol. Its IUPAC name is trimethyl-[1-[4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]silane.
| Compound Name | trimethyl-[1-[4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]silane |
|---|---|
| PubChem CID | 10627055 |
| Molecular Formula | C35H53NO4Si |
| Molecular Weight | 579.90 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | trimethyl-[1-[4-[(E)-2-(4-nitrophenyl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]silane |
| SMILES | C=C(c1cc(OCCCCCCCC)c(/C=C/c2ccc([N+](=O)[O-])cc2)cc1OCCCCCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C35H53NO4Si/c1-7-9-11-13-15-17-25-39-34-28-33(29(3)41(4,5)6)35(40-26-18-16-14-12-10-8-2)27-31(34)22-19-30-20-23-32(24-21-30)36(37)38/h19-24,27-28H,3,7-18,25-26H2,1-2,4-6H3/b22-19+ |
| InChIKey | WOKPAKMSJPUOEU-ZBJSNUHESA-N |
| XLogP | 11.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.90 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|