C7H7I2NO — CID 118990977
2,4-diiodo-6-methoxyaniline (PubChem CID 118990977) has the molecular formula C7H7I2NO and a molecular weight of 374.95 g/mol. Its IUPAC name is 2,4-diiodo-6-methoxyaniline.
| Compound Name | 2,4-diiodo-6-methoxyaniline |
|---|---|
| PubChem CID | 118990977 |
| Molecular Formula | C7H7I2NO |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.86 |
| IUPAC Name | 2,4-diiodo-6-methoxyaniline |
| SMILES | COc1cc(I)cc(I)c1N |
| InChI | InChI=1S/C7H7I2NO/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,10H2,1H3 |
| InChIKey | KUBAAYFFTSJGDN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|