C14H14I2N2O2 — CID 141296455
4-(4-amino-2-iodo-5-methoxyphenyl)-5-iodo-2-methoxyaniline (PubChem CID 141296455) has the molecular formula C14H14I2N2O2 and a molecular weight of 496.09 g/mol. Its IUPAC name is 4-(4-amino-2-iodo-5-methoxyphenyl)-5-iodo-2-methoxyaniline.
| Compound Name | 4-(4-amino-2-iodo-5-methoxyphenyl)-5-iodo-2-methoxyaniline |
|---|---|
| PubChem CID | 141296455 |
| Molecular Formula | C14H14I2N2O2 |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.91 |
| IUPAC Name | 4-(4-amino-2-iodo-5-methoxyphenyl)-5-iodo-2-methoxyaniline |
| SMILES | COc1cc(-c2cc(OC)c(N)cc2I)c(I)cc1N |
| InChI | InChI=1S/C14H14I2N2O2/c1-19-13-3-7(9(15)5-11(13)17)8-4-14(20-2)12(18)6-10(8)16/h3-6H,17-18H2,1-2H3 |
| InChIKey | ORLVWQUOZWONNM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|