C14H12I2O2 — CID 86019037
4-iodo-1-(4-iodo-2-methoxyphenyl)-2-methoxybenzene (PubChem CID 86019037) has the molecular formula C14H12I2O2 and a molecular weight of 466.06 g/mol. Its IUPAC name is 4-iodo-1-(4-iodo-2-methoxyphenyl)-2-methoxybenzene.
| Compound Name | 4-iodo-1-(4-iodo-2-methoxyphenyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 86019037 |
| Molecular Formula | C14H12I2O2 |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | 4-iodo-1-(4-iodo-2-methoxyphenyl)-2-methoxybenzene |
| SMILES | COc1cc(I)ccc1-c1ccc(I)cc1OC |
| InChI | InChI=1S/C14H12I2O2/c1-17-13-7-9(15)3-5-11(13)12-6-4-10(16)8-14(12)18-2/h3-8H,1-2H3 |
| InChIKey | NZNAEJLDJBQOFB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|