About (4-iodo-2-methoxyphenyl) propanoate
(4-iodo-2-methoxyphenyl) propanoate (PubChem CID 129282160) has the molecular formula C10H11IO3
and a molecular weight of 306.10 g/mol. Its IUPAC name is (4-iodo-2-methoxyphenyl) propanoate.
Molecular Properties
| Compound Name | (4-iodo-2-methoxyphenyl) propanoate |
| PubChem CID | 129282160 |
| Molecular Formula | C10H11IO3 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | (4-iodo-2-methoxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1ccc(I)cc1OC |
| InChI | InChI=1S/C10H11IO3/c1-3-10(12)14-8-5-4-7(11)6-9(8)13-2/h4-6H,3H2,1-2H3 |
| InChIKey | VRZBPMSINFNXIJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-iodo-2-methoxyphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodo-2-methoxyphenyl) propanoate?
The IUPAC name of (4-iodo-2-methoxyphenyl) propanoate (CID 129282160) is (4-iodo-2-methoxyphenyl) propanoate.
What is the SMILES notation for (4-iodo-2-methoxyphenyl) propanoate?
The canonical SMILES for (4-iodo-2-methoxyphenyl) propanoate is CCC(=O)Oc1ccc(I)cc1OC.
What is the InChIKey of (4-iodo-2-methoxyphenyl) propanoate?
The InChIKey is VRZBPMSINFNXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO3/c1-3-10(12)14-8-5-4-7(11)6-9(8)13-2/h4-6H,3H2,1-2H3.
What are the key properties of (4-iodo-2-methoxyphenyl) propanoate?
(4-iodo-2-methoxyphenyl) propanoate has a molecular weight of 306.10 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodo-2-methoxyphenyl) propanoate is sourced from PubChem (CID 129282160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).