C22H29IO5 — CID 123134211
ethyl 3,4,5-trimethoxybenzoate;1-iodo-2,3,4,5-tetramethylbenzene (PubChem CID 123134211) has the molecular formula C22H29IO5 and a molecular weight of 500.37 g/mol. Its IUPAC name is ethyl 3,4,5-trimethoxybenzoate;1-iodo-2,3,4,5-tetramethylbenzene.
| Compound Name | ethyl 3,4,5-trimethoxybenzoate;1-iodo-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 123134211 |
| Molecular Formula | C22H29IO5 |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | ethyl 3,4,5-trimethoxybenzoate;1-iodo-2,3,4,5-tetramethylbenzene |
| SMILES | CCOC(=O)c1cc(OC)c(OC)c(OC)c1.Cc1cc(I)c(C)c(C)c1C |
| InChI | InChI=1S/C12H16O5.C10H13I/c1-5-17-12(13)8-6-9(14-2)11(16-4)10(7-8)15-3;1-6-5-10(11)9(4)8(3)7(6)2/h6-7H,5H2,1-4H3;5H,1-4H3 |
| InChIKey | IVDUMXGIDZINBP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|