C15H24N2O5S — CID 120876553
2,4,6-trimethoxy-N-(3-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 120876553) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2,4,6-trimethoxy-N-(3-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2,4,6-trimethoxy-N-(3-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 120876553 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,4,6-trimethoxy-N-(3-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NC2CCNCC2C)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-10-9-16-6-5-12(10)17-23(18,19)15-13(21-3)7-11(20-2)8-14(15)22-4/h7-8,10,12,16-17H,5-6,9H2,1-4H3 |
| InChIKey | DPDYSSPFVCNMEL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |