C16H24N2O5S — CID 120875651
N-cyclopropyl-2,4,6-trimethoxy-N-pyrrolidin-3-ylbenzenesulfonamide (PubChem CID 120875651) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is N-cyclopropyl-2,4,6-trimethoxy-N-pyrrolidin-3-ylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-2,4,6-trimethoxy-N-pyrrolidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 120875651 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-cyclopropyl-2,4,6-trimethoxy-N-pyrrolidin-3-ylbenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)N(C2CC2)C2CCNC2)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O5S/c1-21-13-8-14(22-2)16(15(9-13)23-3)24(19,20)18(11-4-5-11)12-6-7-17-10-12/h8-9,11-12,17H,4-7,10H2,1-3H3 |
| InChIKey | WLPHLVBXJHFNOF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |