C14H22N2O5S — CID 120875335
N-(2-amino-1-cyclopropylethyl)-2,4,6-trimethoxybenzenesulfonamide (PubChem CID 120875335) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2,4,6-trimethoxybenzenesulfonamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2,4,6-trimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 120875335 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2,4,6-trimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NC(CN)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-19-10-6-12(20-2)14(13(7-10)21-3)22(17,18)16-11(8-15)9-4-5-9/h6-7,9,11,16H,4-5,8,15H2,1-3H3 |
| InChIKey | JQVRBWJQTYRCKY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |