C25H21NO6S3 — CID 68688304
3-[2-[3-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688304) has the molecular formula C25H21NO6S3 and a molecular weight of 527.65 g/mol. Its IUPAC name is 3-[2-[3-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 3-[2-[3-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688304 |
| Molecular Formula | C25H21NO6S3 |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 3-[2-[3-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCc2cccc(NS(=O)(=O)c3sccc3S(=O)(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H21NO6S3/c27-24(28)20-8-4-6-18(16-20)12-13-19-7-5-9-21(17-19)26-35(31,32)25-23(14-15-33-25)34(29,30)22-10-2-1-3-11-22/h1-11,14-17,26H,12-13H2,(H,27,28) |
| InChIKey | JJBPDSSFPMSBGN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |