C25H21NO8S3 — CID 68690195
4-[2-[4-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenoxy]ethoxy]benzoic acid (PubChem CID 68690195) has the molecular formula C25H21NO8S3 and a molecular weight of 559.64 g/mol. Its IUPAC name is 4-[2-[4-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[4-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68690195 |
| Molecular Formula | C25H21NO8S3 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 4-[2-[4-[[3-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2ccc(NS(=O)(=O)c3sccc3S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H21NO8S3/c27-24(28)18-6-10-20(11-7-18)33-15-16-34-21-12-8-19(9-13-21)26-37(31,32)25-23(14-17-35-25)36(29,30)22-4-2-1-3-5-22/h1-14,17,26H,15-16H2,(H,27,28) |
| InChIKey | LGZWCVFHKRDOOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|