C26H24F3NO5S — CID 22671983
(E)-3-[4-[[2-[benzenesulfonyl(propyl)amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 22671983) has the molecular formula C26H24F3NO5S and a molecular weight of 519.54 g/mol. Its IUPAC name is (E)-3-[4-[[2-[benzenesulfonyl(propyl)amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[benzenesulfonyl(propyl)amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22671983 |
| Molecular Formula | C26H24F3NO5S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (E)-3-[4-[[2-[benzenesulfonyl(propyl)amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | CCCN(c1ccc(C(F)(F)F)cc1OCc1ccc(/C=C/C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H24F3NO5S/c1-2-16-30(36(33,34)22-6-4-3-5-7-22)23-14-13-21(26(27,28)29)17-24(23)35-18-20-10-8-19(9-11-20)12-15-25(31)32/h3-15,17H,2,16,18H2,1H3,(H,31,32)/b15-12+ |
| InChIKey | GJPFIFUSSDHWOH-NTCAYCPXSA-N |
| XLogP | 5.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|