C25H23F3N2O5S2 — CID 23106434
(E)-3-[4-[[2-[2-methylprop-2-enyl-[(4-methyl-1,3-thiazol-2-yl)sulfonyl]amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 23106434) has the molecular formula C25H23F3N2O5S2 and a molecular weight of 552.60 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-methylprop-2-enyl-[(4-methyl-1,3-thiazol-2-yl)sulfonyl]amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[2-methylprop-2-enyl-[(4-methyl-1,3-thiazol-2-yl)sulfonyl]amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23106434 |
| Molecular Formula | C25H23F3N2O5S2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | (E)-3-[4-[[2-[2-methylprop-2-enyl-[(4-methyl-1,3-thiazol-2-yl)sulfonyl]amino]-5-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C)CN(c1ccc(C(F)(F)F)cc1OCc1ccc(/C=C/C(=O)O)cc1)S(=O)(=O)c1nc(C)cs1 |
| InChI | InChI=1S/C25H23F3N2O5S2/c1-16(2)13-30(37(33,34)24-29-17(3)15-36-24)21-10-9-20(25(26,27)28)12-22(21)35-14-19-6-4-18(5-7-19)8-11-23(31)32/h4-12,15H,1,13-14H2,2-3H3,(H,31,32)/b11-8+ |
| InChIKey | YGSBHCMTJWLIDY-DHZHZOJOSA-N |
| XLogP | 5.92 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|