C26H27NO5S — CID 141001980
3-[3-[[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 141001980) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is 3-[3-[[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141001980 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3-[3-[[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(N(C(C)C)S(=O)(=O)c2ccccc2)c(OCc2cccc(C=CC(=O)O)c2)c1 |
| InChI | InChI=1S/C26H27NO5S/c1-19(2)27(33(30,31)23-10-5-4-6-11-23)24-14-12-20(3)16-25(24)32-18-22-9-7-8-21(17-22)13-15-26(28)29/h4-17,19H,18H2,1-3H3,(H,28,29) |
| InChIKey | SACRBZRDXWQXHU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|