C25H25NO4S — CID 23378603
4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenyl]ethenyl]benzoic acid (PubChem CID 23378603) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 23378603 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[(E)-2-[2-[benzenesulfonyl(propan-2-yl)amino]-5-methylphenyl]ethenyl]benzoic acid |
| SMILES | Cc1ccc(N(C(C)C)S(=O)(=O)c2ccccc2)c(/C=C/c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H25NO4S/c1-18(2)26(31(29,30)23-7-5-4-6-8-23)24-16-9-19(3)17-22(24)15-12-20-10-13-21(14-11-20)25(27)28/h4-18H,1-3H3,(H,27,28)/b15-12+ |
| InChIKey | DIWXKHOQTHKWIJ-NTCAYCPXSA-N |
| XLogP | 5.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|