C17H20F3NO3 — CID 166239737
(2S)-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]butanoic acid (PubChem CID 166239737) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is (2S)-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 166239737 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2S)-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)C1(c2cccc(C(F)(F)F)c2)CCCC1)C(=O)O |
| InChI | InChI=1S/C17H20F3NO3/c1-2-13(14(22)23)21-15(24)16(8-3-4-9-16)11-6-5-7-12(10-11)17(18,19)20/h5-7,10,13H,2-4,8-9H2,1H3,(H,21,24)(H,22,23)/t13-/m0/s1 |
| InChIKey | WZHLEZQBQOGQQR-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |