C17H22F3NO3 — CID 51092273
N-(2-ethoxyethyl)-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide (PubChem CID 51092273) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 51092273 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2-ethoxyethyl)-4-[3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
| SMILES | CCOCCNC(=O)C1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C17H22F3NO3/c1-2-23-11-8-21-15(22)16(6-9-24-10-7-16)13-4-3-5-14(12-13)17(18,19)20/h3-5,12H,2,6-11H2,1H3,(H,21,22) |
| InChIKey | DVRLDPWOKBJLMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|