C22H22F3NO4 — CID 60566825
benzyl 2-[[4-[3-(trifluoromethyl)phenyl]oxane-4-carbonyl]amino]acetate (PubChem CID 60566825) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is benzyl 2-[[4-[3-(trifluoromethyl)phenyl]oxane-4-carbonyl]amino]acetate.
| Compound Name | benzyl 2-[[4-[3-(trifluoromethyl)phenyl]oxane-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 60566825 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | benzyl 2-[[4-[3-(trifluoromethyl)phenyl]oxane-4-carbonyl]amino]acetate |
| SMILES | O=C(CNC(=O)C1(c2cccc(C(F)(F)F)c2)CCOCC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H22F3NO4/c23-22(24,25)18-8-4-7-17(13-18)21(9-11-29-12-10-21)20(28)26-14-19(27)30-15-16-5-2-1-3-6-16/h1-8,13H,9-12,14-15H2,(H,26,28) |
| InChIKey | XAEITKZOBGTWJP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |