C17H21F3O3 — CID 66685195
ethyl 3-[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]propanoate (PubChem CID 66685195) has the molecular formula C17H21F3O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is ethyl 3-[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]propanoate.
| Compound Name | ethyl 3-[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]propanoate |
|---|---|
| PubChem CID | 66685195 |
| Molecular Formula | C17H21F3O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 3-[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C17H21F3O3/c1-2-23-15(21)6-7-16(8-10-22-11-9-16)13-4-3-5-14(12-13)17(18,19)20/h3-5,12H,2,6-11H2,1H3 |
| InChIKey | QBCRWHHNUNEFFN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |