C18H25F3N2O3 — CID 120590246
4-amino-3-methoxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]butanamide (PubChem CID 120590246) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 120590246 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-amino-3-methoxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]butanamide |
| SMILES | COC(CN)CC(=O)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-25-15(11-22)10-16(24)23-12-17(5-7-26-8-6-17)13-3-2-4-14(9-13)18(19,20)21/h2-4,9,15H,5-8,10-12,22H2,1H3,(H,23,24) |
| InChIKey | ALTOBZWRMIYRTI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |